Products 3034-31-9
CAS 3034-31-9 appears in our catalog under these names: N–Phenyl isonicotinicamide, N-Phenyl isonicotinicamide 97%, Isonicotinanilide, 98%+, 98%+, N-Phenyl isonicotinicamide, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 10g.
N-phenylpyridine-4-carboxamide (CAS 3034-31-9) is a chemical compound with the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. IUPAC name: N-phenylpyridine-4-carboxamide. InChIKey: FCTZHFATVFONMW-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | N-phenylpyridine-4-carboxamide |
| InChIKey | FCTZHFATVFONMW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=CC=NC=C2 |
Computed by PubChem (NCBI)