CAS 30341-93-6 is the registry number for Nicergoline Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
(6aR,9R,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-9-carboxylic acid (CAS 30341-93-6) is a chemical compound with the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. IUPAC name: (6aR,9R,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-9-carboxylic acid. InChIKey: SBJSRNIAEBCQDQ-IRUJWGPZSA-N.
| Molecular formula | C15H16N2O2 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | (6aR,9R,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-9-carboxylic acid |
| InChIKey | SBJSRNIAEBCQDQ-IRUJWGPZSA-N |
| SMILES | C1[C@H](CN[C@H]2[C@H]1C3=C4C(=CNC4=CC=C3)C2)C(=O)O |
Computed by PubChem (NCBI)