Products 3036-16-6
CAS 3036-16-6 appears in our catalog under these names: Serotonin Hydrogenoxalate, Serotonin hydrogenoxalate, 5-Hydroxytryptamine, oxalate salt. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 25mg, 50mg, 10g, 5g, 25g, 100g.
3-(2-aminoethyl)-1H-indol-5-ol;oxalic acid (CAS 3036-16-6) is a chemical compound with the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. IUPAC name: 3-(2-aminoethyl)-1H-indol-5-ol;oxalic acid. InChIKey: VTBOICJSERLVPD-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O5 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 3-(2-aminoethyl)-1H-indol-5-ol;oxalic acid |
| InChIKey | VTBOICJSERLVPD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C(=CN2)CCN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
serotonin oxalate, 3-(2-ammonioethyl)-5-hydroxy-1H-indolium oxalate, Serotonin hydrogen oxalate, Serotonin hydrogenoxalate, 5-Hydroxytryptamine oxalate salt, 3-(2-aminoethyl)-1H-indol-5-ol;oxalic acid, 3-(2-Aminoethyl)-5-hydroxyindole hydrogenoxalate, Serotonin hydrogenoxalate, powder, 5-Hydroxytryptamine, oxalate salt, VTBOICJSERLVPD-UHFFFAOYSA-N