CAS 30388-44-4 is the registry number for N-Methyl-n-[4-(methylsulfonyl)-2-nitrophenyl]amine, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
N-methyl-4-methylsulfonyl-2-nitroaniline (CAS 30388-44-4) is a chemical compound with the molecular formula C8H10N2O4S and a molecular weight of 230.24 g/mol. IUPAC name: N-methyl-4-methylsulfonyl-2-nitroaniline. InChIKey: SGWXKSCZDKMSLI-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O4S |
|---|---|
| Molecular weight | 230.24 g/mol |
| IUPAC name | N-methyl-4-methylsulfonyl-2-nitroaniline |
| InChIKey | SGWXKSCZDKMSLI-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1)S(=O)(=O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)