CAS 303995-89-3 is the registry number for 4-Benzoyl-n,n-dimethyl-1h-pyrrole-2-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-benzoyl-N,N-dimethyl-1H-pyrrole-2-carboxamide (CAS 303995-89-3) is a chemical compound with the molecular formula C14H14N2O2 and a molecular weight of 242.27 g/mol. IUPAC name: 4-benzoyl-N,N-dimethyl-1H-pyrrole-2-carboxamide. InChIKey: HFPQVHANMLDDIF-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O2 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 4-benzoyl-N,N-dimethyl-1H-pyrrole-2-carboxamide |
| InChIKey | HFPQVHANMLDDIF-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CN1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)