CAS 30452-35-8 is the registry number for 1-(2-Chlorophenyl)-2,3-dihydro-1H-imidazol-2-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(2-chlorophenyl)-1H-imidazol-2-one (CAS 30452-35-8) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 3-(2-chlorophenyl)-1H-imidazol-2-one. InChIKey: IUCRDQIAOPYLCI-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-1H-imidazol-2-one |
| InChIKey | IUCRDQIAOPYLCI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C=CNC2=O)Cl |
Computed by PubChem (NCBI)