Products 30459-70-2
CAS 30459-70-2 appears in our catalog under these names: 2–Methyl–4–nitrobenzoyl Chloride, 2-Methyl-4-nitrobenzoyl chloride, 2-Methyl-4-nitrobenzoyl chloride 95%, 2-METHYL-4-NITROBENZOYL CHLORIDE, 98%, 2-Methyl-4-nitrobenzoyl chloride, 95%, 95%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 25g, 5g, 1g, 100mg, 100g, on request.
2-methyl-4-nitrobenzoyl chloride (CAS 30459-70-2) is a chemical compound with the molecular formula C8H6ClNO3 and a molecular weight of 199.59 g/mol. IUPAC name: 2-methyl-4-nitrobenzoyl chloride. InChIKey: LMDIDOFTXQERLH-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO3 |
|---|---|
| Molecular weight | 199.59 g/mol |
| IUPAC name | 2-methyl-4-nitrobenzoyl chloride |
| InChIKey | LMDIDOFTXQERLH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)[N+](=O)[O-])C(=O)Cl |
Computed by PubChem (NCBI)