CAS 30486-76-1 appears in our catalog under these names: 4,6-Dichloro-1H-benzo(d)imidazol-2-amine, 95%, 4,6-Dichloro-1H-benzo(D)imidazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4,6-dichloro-1H-benzimidazol-2-amine (CAS 30486-76-1) is a chemical compound with the molecular formula C7H5Cl2N3 and a molecular weight of 202.04 g/mol. IUPAC name: 4,6-dichloro-1H-benzimidazol-2-amine. InChIKey: DAONLTNVFHRQFO-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2N3 |
|---|---|
| Molecular weight | 202.04 g/mol |
| IUPAC name | 4,6-dichloro-1H-benzimidazol-2-amine |
| InChIKey | DAONLTNVFHRQFO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=N2)N)Cl)Cl |
Computed by PubChem (NCBI)