CAS 304876-31-1 appears in our catalog under these names: 5-Bromo-1,2-dihydrospiro[indole-3,4'-oxane]-2-one, 95%, 5-Bromo-2',3',5',6'-tetrahydrospiro(3H-indole-3,4'-(4H)pyran)-2(1H)-one, 98%, 5-bromo-1,2-dihydrospiro(indole-3,4'-oxane)-2-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 0,5g, 50mg.
5-bromospiro[1H-indole-3,4'-oxane]-2-one (CAS 304876-31-1) is a chemical compound with the molecular formula C12H12BrNO2 and a molecular weight of 282.13 g/mol. IUPAC name: 5-bromospiro[1H-indole-3,4'-oxane]-2-one. InChIKey: GEYZZDOKMLGPLQ-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO2 |
|---|---|
| Molecular weight | 282.13 g/mol |
| IUPAC name | 5-bromospiro[1H-indole-3,4'-oxane]-2-one |
| InChIKey | GEYZZDOKMLGPLQ-UHFFFAOYSA-N |
| SMILES | C1COCCC12C3=C(C=CC(=C3)Br)NC2=O |
Computed by PubChem (NCBI)