CAS 3049-31-8 appears in our catalog under these names: 1,4-Phenylene bismethacrylate, 95%, 1,4-PHENYLENE DIMETHACRYLATE, >99.0%, C&, Hydroquinone dimethacrylate, 95%, 95%. Offered by: Combi-blocks, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 100mg, 250mg.
[4-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate (CAS 3049-31-8) is a chemical compound with the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. IUPAC name: [4-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate. InChIKey: MDMKOESKPAVFJF-UHFFFAOYSA-N.
| Molecular formula | C14H14O4 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | [4-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate |
| InChIKey | MDMKOESKPAVFJF-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC1=CC=C(C=C1)OC(=O)C(=C)C |
Computed by PubChem (NCBI)