Products 3053861-26-7
CAS 3053861-26-7 is the registry number for SSE1806. Offered by: MedChemExpress. Available pack sizes: 10 mg, 1 mg, 5 mg.
11-(3-nitrophenyl)-3,6,7,8,9,11-hexahydro-2H-[1,4]benzodioxino[6,7-b]quinolin-10-one (CAS 3053861-26-7) is a chemical compound with the molecular formula C21H18N2O5 and a molecular weight of 378.4 g/mol. IUPAC name: 11-(3-nitrophenyl)-3,6,7,8,9,11-hexahydro-2H-[1,4]benzodioxino[6,7-b]quinolin-10-one. InChIKey: QIBBEPCCDJOQSF-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O5 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | 11-(3-nitrophenyl)-3,6,7,8,9,11-hexahydro-2H-[1,4]benzodioxino[6,7-b]quinolin-10-one |
| InChIKey | QIBBEPCCDJOQSF-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(C3=CC4=C(C=C3N2)OCCO4)C5=CC(=CC=C5)[N+](=O)[O-])C(=O)C1 |
Computed by PubChem (NCBI)