CAS 305811-47-6 is the registry number for 1-Methyl-3-(2-nitro-phenyl)-1h-pyrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-methyl-3-(2-nitrophenyl)pyrazole (CAS 305811-47-6) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 1-methyl-3-(2-nitrophenyl)pyrazole. InChIKey: VQCALXVUMSAFLK-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 1-methyl-3-(2-nitrophenyl)pyrazole |
| InChIKey | VQCALXVUMSAFLK-UHFFFAOYSA-N |
| SMILES | CN1C=CC(=N1)C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)