Products 306325-55-3

CAS 306325-55-3 is the registry number for 2-((3-Carbamoylphenyl)carbamoyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[(3-carbamoylphenyl)carbamoyl]benzoic acid (CAS 306325-55-3) is a chemical compound with the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. IUPAC name: 2-[(3-carbamoylphenyl)carbamoyl]benzoic acid. InChIKey: GJGNUGTYQMWDKJ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H12N2O4
Molecular weight284.27 g/mol
IUPAC name2-[(3-carbamoylphenyl)carbamoyl]benzoic acid
InChIKeyGJGNUGTYQMWDKJ-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)NC2=CC=CC(=C2)C(=O)N)C(=O)O

Computed by PubChem (NCBI)