Products 451460-48-3
CAS 451460-48-3 appears in our catalog under these names: Ethacridine Impurity 4, 9(10H)-acridinone, 2-ethoxy-6-nitro-, 95%. Offered by: Chemat Brand, AmBeed. Available pack sizes: on request, 1g.
2-ethoxy-6-nitro-10H-acridin-9-one (CAS 451460-48-3) is a chemical compound with the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. IUPAC name: 2-ethoxy-6-nitro-10H-acridin-9-one. InChIKey: JZNARYMNAIRMDH-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O4 |
|---|---|
| Molecular weight | 284.27 g/mol |
| IUPAC name | 2-ethoxy-6-nitro-10H-acridin-9-one |
| InChIKey | JZNARYMNAIRMDH-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)NC3=C(C2=O)C=CC(=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)