Products 307339-36-2

CAS 307339-36-2 is the registry number for 2-((4-Carbamoylphenyl)carbamoyl)benzoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[(4-carbamoylphenyl)carbamoyl]benzoic acid (CAS 307339-36-2) is a chemical compound with the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. IUPAC name: 2-[(4-carbamoylphenyl)carbamoyl]benzoic acid. InChIKey: NFSYYODESQQPSX-UHFFFAOYSA-N.

Identity
Molecular formulaC15H12N2O4
Molecular weight284.27 g/mol
IUPAC name2-[(4-carbamoylphenyl)carbamoyl]benzoic acid
InChIKeyNFSYYODESQQPSX-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)NC2=CC=C(C=C2)C(=O)N)C(=O)O

Computed by PubChem (NCBI)