Products 460744-16-5
CAS 460744-16-5 is the registry number for 2-(3,4-Diaminophenyl)-7,8-dihydroxy-4H-chromen-4-one. Offered by: TRC. Available pack sizes: 250mg.
2-(3,4-diaminophenyl)-7,8-dihydroxychromen-4-one (CAS 460744-16-5) is a chemical compound with the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. IUPAC name: 2-(3,4-diaminophenyl)-7,8-dihydroxychromen-4-one. InChIKey: XRQUEUISMRSNHB-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O4 |
|---|---|
| Molecular weight | 284.27 g/mol |
| IUPAC name | 2-(3,4-diaminophenyl)-7,8-dihydroxychromen-4-one |
| InChIKey | XRQUEUISMRSNHB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=O)C3=C(O2)C(=C(C=C3)O)O)N)N |
Computed by PubChem (NCBI)