CAS 938001-71-9 is the registry number for 6-(4-Methoxyphenyl)-3-methyl-(1,2)oxazolo(5,4-b)pyridine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
6-(4-methoxyphenyl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid (CAS 938001-71-9) is a chemical compound with the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. IUPAC name: 6-(4-methoxyphenyl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid. InChIKey: BDPROYIKHJBWFQ-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O4 |
|---|---|
| Molecular weight | 284.27 g/mol |
| IUPAC name | 6-(4-methoxyphenyl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid |
| InChIKey | BDPROYIKHJBWFQ-UHFFFAOYSA-N |
| SMILES | CC1=NOC2=C1C(=CC(=N2)C3=CC=C(C=C3)OC)C(=O)O |
Computed by PubChem (NCBI)