Products 30650-90-9
CAS 30650-90-9 appears in our catalog under these names: Ethyl 3–methyl–4–nitrobenzoate, Ethyl 3-methyl-4-nitrobenzoate 97%, Ethyl 3-Methyl-4-nitrobenzoate, 97%, 97%, Ethyl 3-methyl-4-nitrobenzoate, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250g, 50g, 5g, 10g, 25g, 100g, 500g.
Ethyl 3-methyl-4-nitrobenzoate (CAS 30650-90-9) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: ethyl 3-methyl-4-nitrobenzoate. InChIKey: OAXJZQMFWBIRKF-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | ethyl 3-methyl-4-nitrobenzoate |
| InChIKey | OAXJZQMFWBIRKF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)[N+](=O)[O-])C |
Computed by PubChem (NCBI)