CAS 306934-94-1 is the registry number for 1-(4-Methoxy-phenyl)-5-methyl-1H-pyrazole-4-carbonyl chloride. Offered by: Fluorochem. Available pack sizes: 1g.
1-(4-methoxyphenyl)-5-methylpyrazole-4-carbonyl chloride (CAS 306934-94-1) is a chemical compound with the molecular formula C12H11ClN2O2 and a molecular weight of 250.68 g/mol. IUPAC name: 1-(4-methoxyphenyl)-5-methylpyrazole-4-carbonyl chloride. InChIKey: BJGXXQTZIKOIGR-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O2 |
|---|---|
| Molecular weight | 250.68 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)-5-methylpyrazole-4-carbonyl chloride |
| InChIKey | BJGXXQTZIKOIGR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C2=CC=C(C=C2)OC)C(=O)Cl |
Computed by PubChem (NCBI)