CAS 306937-12-2 appears in our catalog under these names: Boc–3–amino–4–methoxybenzoic acid, 3-((tert-Butoxycarbonyl)amino)-4-methoxybenzoic acid, 97%, 97%, 3-[(tert-Butoxycarbonyl)amino]-4-methoxybenzoic acid, 95%, 3-((tert-Butoxycarbonyl)amino)-4-methoxybenzoic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 5g, 250mg, 10g, 100g.
4-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 306937-12-2) is a chemical compound with the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. IUPAC name: 4-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: HJRQIHYNWZEWHF-UHFFFAOYSA-N.
| Molecular formula | C13H17NO5 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 4-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | HJRQIHYNWZEWHF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CC(=C1)C(=O)O)OC |
Computed by PubChem (NCBI)