CAS 62182-11-0 is the registry number for 4-Deoxy-4-fluoro-a-D-glucopyranose. Offered by: Biosynth. Available pack sizes: 10g.
(2R,3R,4R,5S,6R)-5-fluoro-6-(hydroxymethyl)oxane-2,3,4-triol (CAS 62182-11-0) is a chemical compound with the molecular formula C6H11FO5 and a molecular weight of 182.15 g/mol. IUPAC name: (2R,3R,4R,5S,6R)-5-fluoro-6-(hydroxymethyl)oxane-2,3,4-triol. InChIKey: FIHYONSINSKFAH-VFUOTHLCSA-N.
| Molecular formula | C6H11FO5 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | (2R,3R,4R,5S,6R)-5-fluoro-6-(hydroxymethyl)oxane-2,3,4-triol |
| InChIKey | FIHYONSINSKFAH-VFUOTHLCSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)O)O)F)O |
Computed by PubChem (NCBI)