Products 3070379-34-6

CAS 3070379-34-6 is the registry number for ZLY025, 99.15%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 100 mg, 5 mg, 50 mg.

Structural formula: {0} (CAS {1})

N-(5-methyl-1,3-thiazol-2-yl)-2-[4-(1,3-oxazol-2-yl)phenyl]acetamide (CAS 3070379-34-6) is a chemical compound with the molecular formula C15H13N3O2S and a molecular weight of 299.3 g/mol. IUPAC name: N-(5-methyl-1,3-thiazol-2-yl)-2-[4-(1,3-oxazol-2-yl)phenyl]acetamide. InChIKey: VVSHIGBEBPOAEX-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13N3O2S
Molecular weight299.3 g/mol
IUPAC nameN-(5-methyl-1,3-thiazol-2-yl)-2-[4-(1,3-oxazol-2-yl)phenyl]acetamide
InChIKeyVVSHIGBEBPOAEX-UHFFFAOYSA-N
SMILESCC1=CN=C(S1)NC(=O)CC2=CC=C(C=C2)C3=NC=CO3

Computed by PubChem (NCBI)

Synonyms: orb3176072