CAS 3070379-34-6 is the registry number for ZLY025, 99.15%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 100 mg, 5 mg, 50 mg.
N-(5-methyl-1,3-thiazol-2-yl)-2-[4-(1,3-oxazol-2-yl)phenyl]acetamide (CAS 3070379-34-6) is a chemical compound with the molecular formula C15H13N3O2S and a molecular weight of 299.3 g/mol. IUPAC name: N-(5-methyl-1,3-thiazol-2-yl)-2-[4-(1,3-oxazol-2-yl)phenyl]acetamide. InChIKey: VVSHIGBEBPOAEX-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O2S |
|---|---|
| Molecular weight | 299.3 g/mol |
| IUPAC name | N-(5-methyl-1,3-thiazol-2-yl)-2-[4-(1,3-oxazol-2-yl)phenyl]acetamide |
| InChIKey | VVSHIGBEBPOAEX-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(S1)NC(=O)CC2=CC=C(C=C2)C3=NC=CO3 |
Computed by PubChem (NCBI)