CAS 3082-23-3 is the registry number for 2-Chloro-N-(2-chloro-4-(cyanosulfanyl)phenyl)acetamide. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
[3-chloro-4-[(2-chloroacetyl)amino]phenyl] thiocyanate (CAS 3082-23-3) is a chemical compound with the molecular formula C9H6Cl2N2OS and a molecular weight of 261.13 g/mol. IUPAC name: [3-chloro-4-[(2-chloroacetyl)amino]phenyl] thiocyanate. InChIKey: CGKXKFVZZYQDOA-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2OS |
|---|---|
| Molecular weight | 261.13 g/mol |
| IUPAC name | [3-chloro-4-[(2-chloroacetyl)amino]phenyl] thiocyanate |
| InChIKey | CGKXKFVZZYQDOA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1SC#N)Cl)NC(=O)CCl |
Computed by PubChem (NCBI)