CAS 329219-49-0 appears in our catalog under these names: 3,6-Dichloro-1-benzothiophene-2-carbohydrazide, 95%, 3,6-Dichlorobenzo(b)thiophene-2-carbohydrazide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3,6-dichloro-1-benzothiophene-2-carbohydrazide (CAS 329219-49-0) is a chemical compound with the molecular formula C9H6Cl2N2OS and a molecular weight of 261.13 g/mol. IUPAC name: 3,6-dichloro-1-benzothiophene-2-carbohydrazide. InChIKey: NHXCNDGYHMEGLN-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2OS |
|---|---|
| Molecular weight | 261.13 g/mol |
| IUPAC name | 3,6-dichloro-1-benzothiophene-2-carbohydrazide |
| InChIKey | NHXCNDGYHMEGLN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)SC(=C2Cl)C(=O)NN |
Computed by PubChem (NCBI)