CAS 324578-32-7 is the registry number for 2-((2,6-Dichlorophenyl)amino)thiazol-4(5H)-one, 97%. Offered by: AmBeed. Available pack sizes: 5g.
2-(2,6-dichlorophenyl)imino-1,3-thiazolidin-4-one (CAS 324578-32-7) is a chemical compound with the molecular formula C9H6Cl2N2OS and a molecular weight of 261.13 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)imino-1,3-thiazolidin-4-one. InChIKey: LBQASGLFPCNRNA-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2OS |
|---|---|
| Molecular weight | 261.13 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)imino-1,3-thiazolidin-4-one |
| InChIKey | LBQASGLFPCNRNA-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC(=NC2=C(C=CC=C2Cl)Cl)S1 |
Computed by PubChem (NCBI)