CAS 350997-39-6 appears in our catalog under these names: OGG1–IN–O8, OGG1-IN-08/ 98%, O8 OGG1 Inhibitor - Bio-X â„¢, 3,4-dichloro-1-benzothiophene-2-carbohydrazide, 99%, 99%, O8 OGG1 Inhibitor, min. 95 %, BioScience Grade, 10 mg. Offered by: GLPBio, TargetMol, Biosynth, Chemat, Roth. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 50mg, 100mg, 200mg, 5 mg.
3,4-dichloro-1-benzothiophene-2-carbohydrazide (CAS 350997-39-6) is a chemical compound with the molecular formula C9H6Cl2N2OS and a molecular weight of 261.13 g/mol. IUPAC name: 3,4-dichloro-1-benzothiophene-2-carbohydrazide. InChIKey: HSSHUDKWJRJKPV-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2OS |
|---|---|
| Molecular weight | 261.13 g/mol |
| IUPAC name | 3,4-dichloro-1-benzothiophene-2-carbohydrazide |
| InChIKey | HSSHUDKWJRJKPV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=C(S2)C(=O)NN)Cl |
Computed by PubChem (NCBI)