Products 3268-75-5
CAS 3268-75-5 appears in our catalog under these names: 2-Chloro-N-(6-chlorobenzo(d)thiazol-2-yl)acetamide, 97%, 2-Chloro-N-(6-chloro-benzothiazol-2-yl)-acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-chloro-N-(6-chloro-1,3-benzothiazol-2-yl)acetamide (CAS 3268-75-5) is a chemical compound with the molecular formula C9H6Cl2N2OS and a molecular weight of 261.13 g/mol. IUPAC name: 2-chloro-N-(6-chloro-1,3-benzothiazol-2-yl)acetamide. InChIKey: XUVJLNSGXUWBNT-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2OS |
|---|---|
| Molecular weight | 261.13 g/mol |
| IUPAC name | 2-chloro-N-(6-chloro-1,3-benzothiazol-2-yl)acetamide |
| InChIKey | XUVJLNSGXUWBNT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)SC(=N2)NC(=O)CCl |
Computed by PubChem (NCBI)