Products 30825-45-7
CAS 30825-45-7 is the registry number for Excavatin D. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[(E)-3-methyl-4-[(2S)-4-methyl-5-oxo-2H-furan-2-yl]but-2-enoxy]chromen-2-one (CAS 30825-45-7) is a chemical compound with the molecular formula C19H18O5 and a molecular weight of 326.3 g/mol. IUPAC name: 7-[(E)-3-methyl-4-[(2S)-4-methyl-5-oxo-2H-furan-2-yl]but-2-enoxy]chromen-2-one. InChIKey: CFNMUZCFSDMZPQ-MZTACXPWSA-N.
| Molecular formula | C19H18O5 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | 7-[(E)-3-methyl-4-[(2S)-4-methyl-5-oxo-2H-furan-2-yl]but-2-enoxy]chromen-2-one |
| InChIKey | CFNMUZCFSDMZPQ-MZTACXPWSA-N |
| SMILES | CC1=C[C@@H](OC1=O)C/C(=C/COC2=CC3=C(C=C2)C=CC(=O)O3)/C |
Computed by PubChem (NCBI)
Synonyms:
Excavatin D, orb3179812