CAS 30933-67-6 appears in our catalog under these names: 4,5-Dimethoxy-1H-indole, 95%, 4,5-Dimethoxyindole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,1g.
4,5-dimethoxy-1H-indole (CAS 30933-67-6) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 4,5-dimethoxy-1H-indole. InChIKey: XLORFNDUOILHCM-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 4,5-dimethoxy-1H-indole |
| InChIKey | XLORFNDUOILHCM-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)NC=C2)OC |
Computed by PubChem (NCBI)