CAS 30992-74-6 appears in our catalog under these names: 4,5-Dihydroxy-2H-chromen-2-one, 95%, 4,5-Dihydroxy-2H-chromen-2-one. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5g, 50mg.
4,5-dihydroxychromen-2-one (CAS 30992-74-6) is a chemical compound with the molecular formula C9H6O4 and a molecular weight of 178.14 g/mol. IUPAC name: 4,5-dihydroxychromen-2-one. InChIKey: SSCSOYWLYNIXMZ-UHFFFAOYSA-N.
| Molecular formula | C9H6O4 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 4,5-dihydroxychromen-2-one |
| InChIKey | SSCSOYWLYNIXMZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC(=O)C=C2O)O |
Computed by PubChem (NCBI)