Products 309943-10-0
CAS 309943-10-0 appears in our catalog under these names: 4-(3,5-Dimethyl-piperidin-1-yl)-3-nitro-benzoic acid, 95%, 4-(3,5-Dimethylpiperidin-1-yl)-3-nitrobenzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoic acid (CAS 309943-10-0) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: 4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoic acid. InChIKey: SZOJBAZUEAQOBX-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoic acid |
| InChIKey | SZOJBAZUEAQOBX-UHFFFAOYSA-N |
| SMILES | CC1CC(CN(C1)C2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-])C |
Computed by PubChem (NCBI)