CAS 309976-15-6 is the registry number for 2-Chloro-4-methoxy-1,8-naphthyridine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2-chloro-4-methoxy-1,8-naphthyridine (CAS 309976-15-6) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 2-chloro-4-methoxy-1,8-naphthyridine. InChIKey: BIQPPYGHMXVRFU-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 2-chloro-4-methoxy-1,8-naphthyridine |
| InChIKey | BIQPPYGHMXVRFU-UHFFFAOYSA-N |
| SMILES | COC1=CC(=NC2=C1C=CC=N2)Cl |
Computed by PubChem (NCBI)