CAS 310466-20-7 is the registry number for (1,1'-Biphenyl)-4-ethanimidamide. Offered by: TRC. Available pack sizes: 1g.
2-(4-phenylphenyl)ethanimidamide (CAS 310466-20-7) is a chemical compound with the molecular formula C14H14N2 and a molecular weight of 210.27 g/mol. IUPAC name: 2-(4-phenylphenyl)ethanimidamide. InChIKey: XLQQCUYDKYMXTJ-UHFFFAOYSA-N.
| Molecular formula | C14H14N2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 2-(4-phenylphenyl)ethanimidamide |
| InChIKey | XLQQCUYDKYMXTJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CC(=N)N |
Computed by PubChem (NCBI)