CAS 3112-46-7 appears in our catalog under these names: Mesitylglyoxylic acid, 97%, 2-Mesityl-2-oxoacetic acid 95%, 2-Mesityl-2-oxoacetic acid, 95%, 95%, 2-Mesityl-2-oxoacetic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g.
2-oxo-2-(2,4,6-trimethylphenyl)acetic acid (CAS 3112-46-7) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 2-oxo-2-(2,4,6-trimethylphenyl)acetic acid. InChIKey: IRSQOXNQMAUSTG-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 2-oxo-2-(2,4,6-trimethylphenyl)acetic acid |
| InChIKey | IRSQOXNQMAUSTG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)C(=O)O)C |
Computed by PubChem (NCBI)