CAS 3121-71-9 appears in our catalog under these names: naphthalen-1-yl propanoate, 95%, Naphthalen-1-yl propionate, 95+%, 1–Naphthyl Propionate, Naphthalen-1-yl propionate, 98%, 98%, Naphthalen-1-yl propionate, 98%(GC-MS),RG. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g.
Naphthalen-1-yl propanoate (CAS 3121-71-9) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: naphthalen-1-yl propanoate. InChIKey: FRXPDEZCWCPLIH-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | naphthalen-1-yl propanoate |
| InChIKey | FRXPDEZCWCPLIH-UHFFFAOYSA-N |
| SMILES | CCC(=O)OC1=CC=CC2=CC=CC=C21 |
Computed by PubChem (NCBI)