CAS 31273-66-2 is the registry number for Lamotrigine Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2,3-dichlorobenzoate (CAS 31273-66-2) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: ethyl 2,3-dichlorobenzoate. InChIKey: DFAQGXDIXJVBAQ-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | ethyl 2,3-dichlorobenzoate |
| InChIKey | DFAQGXDIXJVBAQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC=C1)Cl)Cl |
Computed by PubChem (NCBI)