Products 98966-17-7
CAS 98966-17-7 appears in our catalog under these names: Acetaminophen Impurity B, Acetaminophen Impurity 8, N-(5-(Acetylamino)-2-hydroxyphenyl)-N-(4-hydroxyphenyl)acetamide, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 2,5mg, 25mg.
N-[3-(N-acetyl-4-hydroxyanilino)-4-hydroxyphenyl]acetamide (CAS 98966-17-7) is a chemical compound with the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. IUPAC name: N-[3-(N-acetyl-4-hydroxyanilino)-4-hydroxyphenyl]acetamide. InChIKey: NQLVUMFRDUPEJZ-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O4 |
|---|---|
| Molecular weight | 300.31 g/mol |
| IUPAC name | N-[3-(N-acetyl-4-hydroxyanilino)-4-hydroxyphenyl]acetamide |
| InChIKey | NQLVUMFRDUPEJZ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1)O)N(C2=CC=C(C=C2)O)C(=O)C |
Computed by PubChem (NCBI)