Products 312931-06-9
CAS 312931-06-9 appears in our catalog under these names: (3-tert-Butoxyphenyl)boronic acid, 95%, (3-(TERT-BUTOXY)PHENYL)BORONIC ACID, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 100mg.
[3-[(2-methylpropan-2-yl)oxy]phenyl]boronic acid (CAS 312931-06-9) is a chemical compound with the molecular formula C10H15BO3 and a molecular weight of 194.04 g/mol. IUPAC name: [3-[(2-methylpropan-2-yl)oxy]phenyl]boronic acid. InChIKey: NHNUYDRSOHYBSP-UHFFFAOYSA-N.
| Molecular formula | C10H15BO3 |
|---|---|
| Molecular weight | 194.04 g/mol |
| IUPAC name | [3-[(2-methylpropan-2-yl)oxy]phenyl]boronic acid |
| InChIKey | NHNUYDRSOHYBSP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)