Products 313393-17-8
CAS 313393-17-8 is the registry number for (3-(2-chlorophenyl)-5-methylisoxazol-4-yl)-N-cyclopropylformamide. Offered by: Biosynth. Available pack sizes: 250mg.
3-(2-chlorophenyl)-N-cyclopropyl-5-methyl-1,2-oxazole-4-carboxamide (CAS 313393-17-8) is a chemical compound with the molecular formula C14H13ClN2O2 and a molecular weight of 276.72 g/mol. IUPAC name: 3-(2-chlorophenyl)-N-cyclopropyl-5-methyl-1,2-oxazole-4-carboxamide. InChIKey: BALRAIAVPRDVSJ-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O2 |
|---|---|
| Molecular weight | 276.72 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-N-cyclopropyl-5-methyl-1,2-oxazole-4-carboxamide |
| InChIKey | BALRAIAVPRDVSJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2Cl)C(=O)NC3CC3 |
Computed by PubChem (NCBI)