Products 313648-56-5
CAS 313648-56-5 appears in our catalog under these names: Dimethyl 5–ethynylisophthalate, Dimethyl 5-ethynylisophthalate 98%, Dimethyl 5-ethynylisophthalate, 98%, 98%, DIMETHYL 5-ETHYNYLBENZENE-1,3-DIOATE, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg, 500mg, 2.5g.
Dimethyl 5-ethynylbenzene-1,3-dicarboxylate (CAS 313648-56-5) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: dimethyl 5-ethynylbenzene-1,3-dicarboxylate. InChIKey: RSSODPUFUQKWIK-UHFFFAOYSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | dimethyl 5-ethynylbenzene-1,3-dicarboxylate |
| InChIKey | RSSODPUFUQKWIK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C#C)C(=O)OC |
Computed by PubChem (NCBI)