Products 478510-91-7
CAS 478510-91-7 is the registry number for 2'-Deoxyuridine-5′-13C. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxy(113C)methyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 478510-91-7) is a chemical compound with the molecular formula C9H12N2O5 and a molecular weight of 229.19 g/mol. IUPAC name: 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxy(113C)methyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: MXHRCPNRJAMMIM-XUTLZHNASA-N.
| Molecular formula | C9H12N2O5 |
|---|---|
| Molecular weight | 229.19 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxy(113C)methyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | MXHRCPNRJAMMIM-XUTLZHNASA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=CC(=O)NC2=O)[13CH2]O)O |
Computed by PubChem (NCBI)