CAS 3153-44-4 appears in our catalog under these names: 4-(4-Methoxyphenyl)-4-oxobutanoic acid 98%, 4-(4-Methoxyphenyl)-4-oxobutyric acid, 98%, 4-(4-Methoxyphenyl)-4-oxobutanoic acid, 98%, 98%, 3–(4–Methoxybenzoyl)propionic acid, 3-(4-Methoxybenzoyl)propionic acid/ 98+%. Offered by: Ambeed, Fluorochem, Chemat, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, on request.
4-(4-methoxyphenyl)-4-oxobutanoic acid (CAS 3153-44-4) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 4-(4-methoxyphenyl)-4-oxobutanoic acid. InChIKey: OMTDIBZSUZNVJK-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)-4-oxobutanoic acid |
| InChIKey | OMTDIBZSUZNVJK-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)