Products 31570-39-5
CAS 31570-39-5 is the registry number for Cembrene A. Offered by: MedChemExpress. Available pack sizes: Get quote.
(R)-cembrene A is a fourteen-membered macrocyclic diterpene consisting of 1,5,9-trimethyl-12-(prop-1-en-2-yl)cyclotetradecane having three endocyclic double bonds located at positions 1, 5 and 9. It has a role as an animal metabolite, a coral metabolite, a plant metabolite and a bacterial metabolite. It is a diterpene, a cycloalkatriene and a macrocycle. It derives from a hydride of a cembrane.
Source: ChEBI
| Molecular formula | C20H32 |
|---|---|
| Molecular weight | 272.5 g/mol |
| IUPAC name | (1E,5E,9E,12R)-1,5,9-trimethyl-12-prop-1-en-2-ylcyclotetradeca-1,5,9-triene |
| InChIKey | VWSPQDDPRITBAM-KPGNMOGWSA-N |
| SMILES | C/C/1=C\CC/C(=C/C[C@@H](CC/C(=C/CC1)/C)C(=C)C)/C |
Computed by PubChem (NCBI)
Synonyms:
Neocembrene, Neocembrene A, (-)-Cembrene A, (R)-(-)-Cembrene A, (1E,5E,9E,12R)-1,5,9-trimethyl-12-prop-1-en-2-ylcyclotetradeca-1,5,9-triene, Cembrene A, (R)-cembrene A, 1,5,9-Trimethyl-12-(1-methylethenyl)-1,5,9-cyclotetradecatriene, (1E,5E,9E,12R)-1,5,9-trimethyl-12-(prop-1-en-2-yl)cyclotetradeca-1,5,9-triene, Cembren A