Products 72691-72-6
CAS 72691-72-6 is the registry number for (+)-Cembrene A. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1Z,5Z,9E,12S)-1,5,9-trimethyl-12-prop-1-en-2-ylcyclotetradeca-1,5,9-triene (CAS 72691-72-6) is a chemical compound with the molecular formula C20H32 and a molecular weight of 272.5 g/mol. IUPAC name: (1Z,5Z,9E,12S)-1,5,9-trimethyl-12-prop-1-en-2-ylcyclotetradeca-1,5,9-triene. InChIKey: VWSPQDDPRITBAM-LWASFLGHSA-N.
| Molecular formula | C20H32 |
|---|---|
| Molecular weight | 272.5 g/mol |
| IUPAC name | (1Z,5Z,9E,12S)-1,5,9-trimethyl-12-prop-1-en-2-ylcyclotetradeca-1,5,9-triene |
| InChIKey | VWSPQDDPRITBAM-LWASFLGHSA-N |
| SMILES | C/C/1=C/CC/C(=C/C[C@H](CC/C(=C\CC1)/C)C(=C)C)/C |
Computed by PubChem (NCBI)