Products 469-86-3
CAS 469-86-3 appears in our catalog under these names: (+)–Phyllocladene, (+)-Phyllocladene. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
(1S,4S,9S,10S,13R)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane (CAS 469-86-3) is a chemical compound with the molecular formula C20H32 and a molecular weight of 272.5 g/mol. IUPAC name: (1S,4S,9S,10S,13R)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane. InChIKey: ONVABDHFQKWOSV-FPPGBKCQSA-N.
| Molecular formula | C20H32 |
|---|---|
| Molecular weight | 272.5 g/mol |
| IUPAC name | (1S,4S,9S,10S,13R)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane |
| InChIKey | ONVABDHFQKWOSV-FPPGBKCQSA-N |
| SMILES | C[C@]12CCCC([C@@H]1CC[C@]34[C@@H]2CC[C@H](C3)C(=C)C4)(C)C |
Computed by PubChem (NCBI)
Synonyms:
Phyllocladene, (+)-phyllocladene