CAS 562-28-7 appears in our catalog under these names: Ent-Kaurene, Ent-Kaurene (>90%), Ent–kaurene. Offered by: Chemat Brand, TRC, GLPBio. Available pack sizes: on request, 10mg, 1mg.
Ent-kaurene is a tetracyclic diterpene consisting of ent-kaurane, where the 6-methyl group is replaced by methylene. It derives from a hydride of an ent-kaurane.
Source: ChEBI
| Molecular formula | C20H32 |
|---|---|
| Molecular weight | 272.5 g/mol |
| IUPAC name | (1S,4R,9R,10R,13R)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane |
| InChIKey | ONVABDHFQKWOSV-HPUSYDDDSA-N |
| SMILES | C[C@@]12CCCC([C@H]1CC[C@]34[C@H]2CC[C@H](C3)C(=C)C4)(C)C |
Computed by PubChem (NCBI)