Products 386223-19-4
CAS 386223-19-4 is the registry number for Verticilla-4(20),7,11-triene. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4E,11S)-4,14,15,15-tetramethyl-8-methylidenebicyclo[9.3.1]pentadeca-1(14),4-diene (CAS 386223-19-4) is a chemical compound with the molecular formula C20H32 and a molecular weight of 272.5 g/mol. IUPAC name: (4E,11S)-4,14,15,15-tetramethyl-8-methylidenebicyclo[9.3.1]pentadeca-1(14),4-diene. InChIKey: SNPPNYAGNBWZCL-WHMKARLCSA-N.
| Molecular formula | C20H32 |
|---|---|
| Molecular weight | 272.5 g/mol |
| IUPAC name | (4E,11S)-4,14,15,15-tetramethyl-8-methylidenebicyclo[9.3.1]pentadeca-1(14),4-diene |
| InChIKey | SNPPNYAGNBWZCL-WHMKARLCSA-N |
| SMILES | C/C/1=C\CCC(=C)CC[C@H]2CCC(=C(C2(C)C)CC1)C |
Computed by PubChem (NCBI)