Products 31604-39-4

CAS 31604-39-4 is the registry number for 2-(4-Nitrophenyl)isoindoline-1,3-dione, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-(4-nitrophenyl)isoindole-1,3-dione (CAS 31604-39-4) is a chemical compound with the molecular formula C14H8N2O4 and a molecular weight of 268.22 g/mol. IUPAC name: 2-(4-nitrophenyl)isoindole-1,3-dione. InChIKey: PHBJJKVNDZUAGC-UHFFFAOYSA-N.

Identity
Molecular formulaC14H8N2O4
Molecular weight268.22 g/mol
IUPAC name2-(4-nitrophenyl)isoindole-1,3-dione
InChIKeyPHBJJKVNDZUAGC-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)N(C2=O)C3=CC=C(C=C3)[N+](=O)[O-]

Computed by PubChem (NCBI)