CAS 3167-10-0 appears in our catalog under these names: 2,4,6-Trimethylphenethylamine hydrochloride, 95%, 2–(2,4,6–trimethylphenyl)ethan–1–amine hydrochloride, 2,4,6-TRIMETHYLPHENETHYLAMINE HYDROCHLO&. Offered by: Combi-blocks, GLPBio, Sigma-Aldrich. Available pack sizes: 10g, 5g, 1g, 250mg.
2-(2,4,6-trimethylphenyl)ethanamine;hydrochloride (CAS 3167-10-0) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: 2-(2,4,6-trimethylphenyl)ethanamine;hydrochloride. InChIKey: JWLMPZNZDSXSQN-UHFFFAOYSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | 2-(2,4,6-trimethylphenyl)ethanamine;hydrochloride |
| InChIKey | JWLMPZNZDSXSQN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)CCN)C.Cl |
Computed by PubChem (NCBI)