CAS 317854-65-2 appears in our catalog under these names: 3-Formyl-1H-indole-7-carboxylic acid, 98%, 3-Formyl-1H-indole-7-carboxylic acid, 95% , 3-Formyl-1h-indole-7-carboxylic acid, 97%, 97%. Offered by: AmBeed, Thermo Scientific, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg, 500mg.
3-formyl-1H-indole-7-carboxylic acid (CAS 317854-65-2) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 3-formyl-1H-indole-7-carboxylic acid. InChIKey: HABYJDPNVBUDGD-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 3-formyl-1H-indole-7-carboxylic acid |
| InChIKey | HABYJDPNVBUDGD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)O)NC=C2C=O |
Computed by PubChem (NCBI)